C15H14ClN3S — CID 83217231
3-(5-chlorothiophen-2-yl)-1-(2,5-dimethylphenyl)pyrazol-4-amine (PubChem CID 83217231) has the molecular formula C15H14ClN3S and a molecular weight of 303.82 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)-1-(2,5-dimethylphenyl)pyrazol-4-amine.
| Compound Name | 3-(5-chlorothiophen-2-yl)-1-(2,5-dimethylphenyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 83217231 |
| Molecular Formula | C15H14ClN3S |
| Molecular Weight | 303.82 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)-1-(2,5-dimethylphenyl)pyrazol-4-amine |
| SMILES | Cc1ccc(C)c(-n2cc(N)c(-c3ccc(Cl)s3)n2)c1 |
| InChI | InChI=1S/C15H14ClN3S/c1-9-3-4-10(2)12(7-9)19-8-11(17)15(18-19)13-5-6-14(16)20-13/h3-8H,17H2,1-2H3 |
| InChIKey | PPOSSPSQKXXTTB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.82 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |