C15H15N3O — CID 83217234
1-(2,5-dimethylphenyl)-3-(furan-3-yl)pyrazol-4-amine (PubChem CID 83217234) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-(furan-3-yl)pyrazol-4-amine.
| Compound Name | 1-(2,5-dimethylphenyl)-3-(furan-3-yl)pyrazol-4-amine |
|---|---|
| PubChem CID | 83217234 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-(furan-3-yl)pyrazol-4-amine |
| SMILES | Cc1ccc(C)c(-n2cc(N)c(-c3ccoc3)n2)c1 |
| InChI | InChI=1S/C15H15N3O/c1-10-3-4-11(2)14(7-10)18-8-13(16)15(17-18)12-5-6-19-9-12/h3-9H,16H2,1-2H3 |
| InChIKey | FAOTUHFVBZQHIV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |