C21H24N4O5 — CID 167726770
4-[[azetidin-3-yl(oxolan-3-yl)amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167726770) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is 4-[[azetidin-3-yl(oxolan-3-yl)amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[azetidin-3-yl(oxolan-3-yl)amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167726770 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 4-[[azetidin-3-yl(oxolan-3-yl)amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(CN(C4CNC4)C4CCOC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H24N4O5/c26-17-5-4-16(19(27)23-17)25-20(28)15-3-1-2-12(18(15)21(25)29)10-24(14-8-22-9-14)13-6-7-30-11-13/h1-3,13-14,16,22H,4-11H2,(H,23,26,27) |
| InChIKey | ZRNQYOWNWTVRQW-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|