C21H26N4O5 — CID 167727552
4-[[[4-(aminomethyl)oxan-4-yl]-methylamino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167727552) has the molecular formula C21H26N4O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is 4-[[[4-(aminomethyl)oxan-4-yl]-methylamino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[[4-(aminomethyl)oxan-4-yl]-methylamino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167727552 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 4-[[[4-(aminomethyl)oxan-4-yl]-methylamino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CN(Cc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)C1(CN)CCOCC1 |
| InChI | InChI=1S/C21H26N4O5/c1-24(21(12-22)7-9-30-10-8-21)11-13-3-2-4-14-17(13)20(29)25(19(14)28)15-5-6-16(26)23-18(15)27/h2-4,15H,5-12,22H2,1H3,(H,23,26,27) |
| InChIKey | SGENFSLDROKUCF-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|