C20H21N5O4 — CID 167727346
3-[3-oxo-4-[(4,5,6,7-tetrahydro-[1,2]oxazolo[4,3-c]pyridin-3-ylamino)methyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167727346) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is 3-[3-oxo-4-[(4,5,6,7-tetrahydro-[1,2]oxazolo[4,3-c]pyridin-3-ylamino)methyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-4-[(4,5,6,7-tetrahydro-[1,2]oxazolo[4,3-c]pyridin-3-ylamino)methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167727346 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 3-[3-oxo-4-[(4,5,6,7-tetrahydro-[1,2]oxazolo[4,3-c]pyridin-3-ylamino)methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cccc(CNc4onc5c4CNCC5)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H21N5O4/c26-16-5-4-15(18(27)23-16)25-10-12-3-1-2-11(17(12)20(25)28)8-22-19-13-9-21-7-6-14(13)24-29-19/h1-3,15,21-22H,4-10H2,(H,23,26,27) |
| InChIKey | UALJFJZQUWJPFK-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|