C14H18BNO4 — CID 167728192
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1,3-benzoxazin-2-one (PubChem CID 167728192) has the molecular formula C14H18BNO4 and a molecular weight of 275.11 g/mol. Its IUPAC name is 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1,3-benzoxazin-2-one.
| Compound Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1,3-benzoxazin-2-one |
|---|---|
| PubChem CID | 167728192 |
| Molecular Formula | C14H18BNO4 |
| Molecular Weight | 275.11 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1,3-benzoxazin-2-one |
| SMILES | CC1(C)OB(c2cccc3c2CNC(=O)O3)OC1(C)C |
| InChI | InChI=1S/C14H18BNO4/c1-13(2)14(3,4)20-15(19-13)10-6-5-7-11-9(10)8-16-12(17)18-11/h5-7H,8H2,1-4H3,(H,16,17) |
| InChIKey | FILUSYWKHIKZOU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.11 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|