C21H23N5O4S — CID 167728983
5-[[[4-[(1S)-1-amino-2-methylpropyl]-1,3-thiazol-2-yl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167728983) has the molecular formula C21H23N5O4S and a molecular weight of 441.51 g/mol. Its IUPAC name is 5-[[[4-[(1S)-1-amino-2-methylpropyl]-1,3-thiazol-2-yl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[[4-[(1S)-1-amino-2-methylpropyl]-1,3-thiazol-2-yl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167728983 |
| Molecular Formula | C21H23N5O4S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 5-[[[4-[(1S)-1-amino-2-methylpropyl]-1,3-thiazol-2-yl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CC(C)[C@H](N)c1csc(NCc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)n1 |
| InChI | InChI=1S/C21H23N5O4S/c1-10(2)17(22)14-9-31-21(24-14)23-8-11-3-4-12-13(7-11)20(30)26(19(12)29)15-5-6-16(27)25-18(15)28/h3-4,7,9-10,15,17H,5-6,8,22H2,1-2H3,(H,23,24)(H,25,27,28)/t15?,17-/m0/s1 |
| InChIKey | UZWHOOFXNHHWIQ-LWKPJOBUSA-N |
| XLogP | 1.81 |
| TPSA | 134.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|