C23H27N5O4 — CID 167731607
3-[3-oxo-7-[[(3-piperidin-4-yl-1,2-oxazol-5-yl)methylamino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167731607) has the molecular formula C23H27N5O4 and a molecular weight of 437.50 g/mol. Its IUPAC name is 3-[3-oxo-7-[[(3-piperidin-4-yl-1,2-oxazol-5-yl)methylamino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-7-[[(3-piperidin-4-yl-1,2-oxazol-5-yl)methylamino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167731607 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 3-[3-oxo-7-[[(3-piperidin-4-yl-1,2-oxazol-5-yl)methylamino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(CNCc4cc(C5CCNCC5)no4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H27N5O4/c29-21-5-4-20(22(30)26-21)28-13-18-15(2-1-3-17(18)23(28)31)11-25-12-16-10-19(27-32-16)14-6-8-24-9-7-14/h1-3,10,14,20,24-25H,4-9,11-13H2,(H,26,29,30) |
| InChIKey | CUOXNNPQDKPNKN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|