C21H25N7O3 — CID 167714798
3-[3-oxo-7-[[(3-piperazin-1-yl-1H-pyrazol-5-yl)amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167714798) has the molecular formula C21H25N7O3 and a molecular weight of 423.48 g/mol. Its IUPAC name is 3-[3-oxo-7-[[(3-piperazin-1-yl-1H-pyrazol-5-yl)amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-7-[[(3-piperazin-1-yl-1H-pyrazol-5-yl)amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167714798 |
| Molecular Formula | C21H25N7O3 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 3-[3-oxo-7-[[(3-piperazin-1-yl-1H-pyrazol-5-yl)amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(CNc4cc(N5CCNCC5)n[nH]4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H25N7O3/c29-19-5-4-16(20(30)24-19)28-12-15-13(2-1-3-14(15)21(28)31)11-23-17-10-18(26-25-17)27-8-6-22-7-9-27/h1-3,10,16,22H,4-9,11-12H2,(H2,23,25,26)(H,24,29,30) |
| InChIKey | MGQYTZTUFDJNPT-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|