C13H14BrNO5 — CID 167732051
2-[3-bromo-5-[(prop-2-enoxycarbonylamino)methyl]phenoxy]acetic acid (PubChem CID 167732051) has the molecular formula C13H14BrNO5 and a molecular weight of 344.16 g/mol. Its IUPAC name is 2-[3-bromo-5-[(prop-2-enoxycarbonylamino)methyl]phenoxy]acetic acid.
| Compound Name | 2-[3-bromo-5-[(prop-2-enoxycarbonylamino)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 167732051 |
| Molecular Formula | C13H14BrNO5 |
| Molecular Weight | 344.16 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | 2-[3-bromo-5-[(prop-2-enoxycarbonylamino)methyl]phenoxy]acetic acid |
| SMILES | C=CCOC(=O)NCc1cc(Br)cc(OCC(=O)O)c1 |
| InChI | InChI=1S/C13H14BrNO5/c1-2-3-19-13(18)15-7-9-4-10(14)6-11(5-9)20-8-12(16)17/h2,4-6H,1,3,7-8H2,(H,15,18)(H,16,17) |
| InChIKey | GGKCOOLURSFHHY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.16 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|