C13H19NO5 — CID 167732092
4-[(prop-2-enoxycarbonylamino)methyl]-2-oxabicyclo[2.2.2]octane-1-carboxylic acid (PubChem CID 167732092) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is 4-[(prop-2-enoxycarbonylamino)methyl]-2-oxabicyclo[2.2.2]octane-1-carboxylic acid.
| Compound Name | 4-[(prop-2-enoxycarbonylamino)methyl]-2-oxabicyclo[2.2.2]octane-1-carboxylic acid |
|---|---|
| PubChem CID | 167732092 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 4-[(prop-2-enoxycarbonylamino)methyl]-2-oxabicyclo[2.2.2]octane-1-carboxylic acid |
| SMILES | C=CCOC(=O)NCC12CCC(C(=O)O)(CC1)OC2 |
| InChI | InChI=1S/C13H19NO5/c1-2-7-18-11(17)14-8-12-3-5-13(6-4-12,10(15)16)19-9-12/h2H,1,3-9H2,(H,14,17)(H,15,16) |
| InChIKey | OEKQZJNYVJCFIX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|