C19H18N2O2S2 — CID 16773325
4-methyl-6-(3-phenylpropylsulfanyl)-2-thiophen-2-ylpyrimidine-5-carboxylic acid (PubChem CID 16773325) has the molecular formula C19H18N2O2S2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 4-methyl-6-(3-phenylpropylsulfanyl)-2-thiophen-2-ylpyrimidine-5-carboxylic acid.
| Compound Name | 4-methyl-6-(3-phenylpropylsulfanyl)-2-thiophen-2-ylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 16773325 |
| Molecular Formula | C19H18N2O2S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 4-methyl-6-(3-phenylpropylsulfanyl)-2-thiophen-2-ylpyrimidine-5-carboxylic acid |
| SMILES | Cc1nc(-c2cccs2)nc(SCCCc2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C19H18N2O2S2/c1-13-16(19(22)23)18(21-17(20-13)15-10-6-11-24-15)25-12-5-9-14-7-3-2-4-8-14/h2-4,6-8,10-11H,5,9,12H2,1H3,(H,22,23) |
| InChIKey | RECMHNXAOCISOS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|