C20H17FN2O2S — CID 16774466
2-(4-fluorophenyl)-4-methyl-6-(2-phenylethylsulfanyl)pyrimidine-5-carboxylic acid (PubChem CID 16774466) has the molecular formula C20H17FN2O2S and a molecular weight of 368.43 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-methyl-6-(2-phenylethylsulfanyl)pyrimidine-5-carboxylic acid.
| Compound Name | 2-(4-fluorophenyl)-4-methyl-6-(2-phenylethylsulfanyl)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 16774466 |
| Molecular Formula | C20H17FN2O2S |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 2-(4-fluorophenyl)-4-methyl-6-(2-phenylethylsulfanyl)pyrimidine-5-carboxylic acid |
| SMILES | Cc1nc(-c2ccc(F)cc2)nc(SCCc2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C20H17FN2O2S/c1-13-17(20(24)25)19(26-12-11-14-5-3-2-4-6-14)23-18(22-13)15-7-9-16(21)10-8-15/h2-10H,11-12H2,1H3,(H,24,25) |
| InChIKey | KYHFFQPRGAMULK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |