C13H11BrN2O2S — CID 16776763
2-(4-bromophenyl)-4-methyl-6-methylsulfanylpyrimidine-5-carboxylic acid (PubChem CID 16776763) has the molecular formula C13H11BrN2O2S and a molecular weight of 339.21 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4-methyl-6-methylsulfanylpyrimidine-5-carboxylic acid.
| Compound Name | 2-(4-bromophenyl)-4-methyl-6-methylsulfanylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 16776763 |
| Molecular Formula | C13H11BrN2O2S |
| Molecular Weight | 339.21 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | 2-(4-bromophenyl)-4-methyl-6-methylsulfanylpyrimidine-5-carboxylic acid |
| SMILES | CSc1nc(-c2ccc(Br)cc2)nc(C)c1C(=O)O |
| InChI | InChI=1S/C13H11BrN2O2S/c1-7-10(13(17)18)12(19-2)16-11(15-7)8-3-5-9(14)6-4-8/h3-6H,1-2H3,(H,17,18) |
| InChIKey | CMGIODAFXQNGTJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.21 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |