C17H19F3N4O3 — CID 167739034
3-[6-[[(3-amino-1,1,1-trifluoropropan-2-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167739034) has the molecular formula C17H19F3N4O3 and a molecular weight of 384.36 g/mol. Its IUPAC name is 3-[6-[[(3-amino-1,1,1-trifluoropropan-2-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[(3-amino-1,1,1-trifluoropropan-2-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167739034 |
| Molecular Formula | C17H19F3N4O3 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 3-[6-[[(3-amino-1,1,1-trifluoropropan-2-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | NCC(NCc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O)C(F)(F)F |
| InChI | InChI=1S/C17H19F3N4O3/c18-17(19,20)13(6-21)22-7-9-1-2-11-10(5-9)8-24(16(11)27)12-3-4-14(25)23-15(12)26/h1-2,5,12-13,22H,3-4,6-8,21H2,(H,23,25,26) |
| InChIKey | HPSAJTSWDAZBAK-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|