C9H8FNO5S — CID 167739166
3-acetamido-4-fluorosulfonylbenzoic acid (PubChem CID 167739166) has the molecular formula C9H8FNO5S and a molecular weight of 261.23 g/mol. Its IUPAC name is 3-acetamido-4-fluorosulfonylbenzoic acid.
| Compound Name | 3-acetamido-4-fluorosulfonylbenzoic acid |
|---|---|
| PubChem CID | 167739166 |
| Molecular Formula | C9H8FNO5S |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 3-acetamido-4-fluorosulfonylbenzoic acid |
| SMILES | CC(=O)Nc1cc(C(=O)O)ccc1S(=O)(=O)F |
| InChI | InChI=1S/C9H8FNO5S/c1-5(12)11-7-4-6(9(13)14)2-3-8(7)17(10,15)16/h2-4H,1H3,(H,11,12)(H,13,14) |
| InChIKey | BZHSQZPLMVRTRY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |