C20H24N4O5S — CID 167740416
3-[7-[[(4aS,7aR)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167740416) has the molecular formula C20H24N4O5S and a molecular weight of 432.50 g/mol. Its IUPAC name is 3-[7-[[(4aS,7aR)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[(4aS,7aR)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167740416 |
| Molecular Formula | C20H24N4O5S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 3-[7-[[(4aS,7aR)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(CN4CCN[C@H]5CS(=O)(=O)C[C@H]54)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H24N4O5S/c25-18-5-4-16(19(26)22-18)24-9-14-12(2-1-3-13(14)20(24)27)8-23-7-6-21-15-10-30(28,29)11-17(15)23/h1-3,15-17,21H,4-11H2,(H,22,25,26)/t15-,16?,17+/m0/s1 |
| InChIKey | GGFXSLDFZXPQPV-RPCGPGEBSA-N |
| XLogP | -0.98 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|