C18H19NO3S — CID 167746405
N-[[4-(2-cyclopropylethynyl)phenyl]methyl]-2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetamide (PubChem CID 167746405) has the molecular formula C18H19NO3S and a molecular weight of 329.42 g/mol. Its IUPAC name is N-[[4-(2-cyclopropylethynyl)phenyl]methyl]-2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetamide.
| Compound Name | N-[[4-(2-cyclopropylethynyl)phenyl]methyl]-2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetamide |
|---|---|
| PubChem CID | 167746405 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | N-[[4-(2-cyclopropylethynyl)phenyl]methyl]-2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetamide |
| SMILES | O=C(CC1C=CS(=O)(=O)C1)NCc1ccc(C#CC2CC2)cc1 |
| InChI | InChI=1S/C18H19NO3S/c20-18(11-17-9-10-23(21,22)13-17)19-12-16-7-5-15(6-8-16)4-3-14-1-2-14/h5-10,14,17H,1-2,11-13H2,(H,19,20) |
| InChIKey | CATQXJYGZMUHRQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|