C17H23N5O2 — CID 167749248
2-methyl-N-[2-[methyl(piperidin-3-yl)amino]-2-oxoethyl]indazole-6-carboxamide (PubChem CID 167749248) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-methyl-N-[2-[methyl(piperidin-3-yl)amino]-2-oxoethyl]indazole-6-carboxamide.
| Compound Name | 2-methyl-N-[2-[methyl(piperidin-3-yl)amino]-2-oxoethyl]indazole-6-carboxamide |
|---|---|
| PubChem CID | 167749248 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 2-methyl-N-[2-[methyl(piperidin-3-yl)amino]-2-oxoethyl]indazole-6-carboxamide |
| SMILES | CN(C(=O)CNC(=O)c1ccc2cn(C)nc2c1)C1CCCNC1 |
| InChI | InChI=1S/C17H23N5O2/c1-21-11-13-6-5-12(8-15(13)20-21)17(24)19-10-16(23)22(2)14-4-3-7-18-9-14/h5-6,8,11,14,18H,3-4,7,9-10H2,1-2H3,(H,19,24) |
| InChIKey | SRLFNKYTWRUQQN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |