About 5-chloro-2-[(4,4-difluoropiperidin-1-yl)sulfonylamino]benzamide
5-chloro-2-[(4,4-difluoropiperidin-1-yl)sulfonylamino]benzamide (PubChem CID 167750162) has the molecular formula C12H14ClF2N3O3S
and a molecular weight of 353.78 g/mol. Its IUPAC name is 5-chloro-2-[(4,4-difluoropiperidin-1-yl)sulfonylamino]benzamide.
Molecular Properties
| Compound Name | 5-chloro-2-[(4,4-difluoropiperidin-1-yl)sulfonylamino]benzamide |
| PubChem CID | 167750162 |
| Molecular Formula | C12H14ClF2N3O3S |
| Molecular Weight | 353.78 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 5-chloro-2-[(4,4-difluoropiperidin-1-yl)sulfonylamino]benzamide |
| SMILES | NC(=O)c1cc(Cl)ccc1NS(=O)(=O)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H14ClF2N3O3S/c13-8-1-2-10(9(7-8)11(16)19)17-22(20,21)18-5-3-12(14,15)4-6-18/h1-2,7,17H,3-6H2,(H2,16,19) |
| InChIKey | CVXUBICSCYJVEL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.78 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-2-[(4,4-difluoropiperidin-1-yl)sulfonylamino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[(4,4-difluoropiperidin-1-yl)sulfonylamino]benzamide?
The IUPAC name of 5-chloro-2-[(4,4-difluoropiperidin-1-yl)sulfonylamino]benzamide (CID 167750162) is 5-chloro-2-[(4,4-difluoropiperidin-1-yl)sulfonylamino]benzamide.
What is the SMILES notation for 5-chloro-2-[(4,4-difluoropiperidin-1-yl)sulfonylamino]benzamide?
The canonical SMILES for 5-chloro-2-[(4,4-difluoropiperidin-1-yl)sulfonylamino]benzamide is NC(=O)c1cc(Cl)ccc1NS(=O)(=O)N1CCC(F)(F)CC1.
What is the InChIKey of 5-chloro-2-[(4,4-difluoropiperidin-1-yl)sulfonylamino]benzamide?
The InChIKey is CVXUBICSCYJVEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClF2N3O3S/c13-8-1-2-10(9(7-8)11(16)19)17-22(20,21)18-5-3-12(14,15)4-6-18/h1-2,7,17H,3-6H2,(H2,16,19).
What are the key properties of 5-chloro-2-[(4,4-difluoropiperidin-1-yl)sulfonylamino]benzamide?
5-chloro-2-[(4,4-difluoropiperidin-1-yl)sulfonylamino]benzamide has a molecular weight of 353.78 g/mol, XLogP of 1.83, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[(4,4-difluoropiperidin-1-yl)sulfonylamino]benzamide is sourced from PubChem (CID 167750162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).