C12H14ClF2N3O3S — CID 167750162
5-chloro-2-[(4,4-difluoropiperidin-1-yl)sulfonylamino]benzamide (PubChem CID 167750162) has the molecular formula C12H14ClF2N3O3S and a molecular weight of 353.78 g/mol. Its IUPAC name is 5-chloro-2-[(4,4-difluoropiperidin-1-yl)sulfonylamino]benzamide.
| Compound Name | 5-chloro-2-[(4,4-difluoropiperidin-1-yl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 167750162 |
| Molecular Formula | C12H14ClF2N3O3S |
| Molecular Weight | 353.78 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 5-chloro-2-[(4,4-difluoropiperidin-1-yl)sulfonylamino]benzamide |
| SMILES | NC(=O)c1cc(Cl)ccc1NS(=O)(=O)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H14ClF2N3O3S/c13-8-1-2-10(9(7-8)11(16)19)17-22(20,21)18-5-3-12(14,15)4-6-18/h1-2,7,17H,3-6H2,(H2,16,19) |
| InChIKey | CVXUBICSCYJVEL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.78 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |