C19H30N4O5 — CID 167750165
2-(carbamoylamino)-N-[2-hydroxy-3-[(3-hydroxy-2-phenylpropanoyl)amino]propyl]hexanamide (PubChem CID 167750165) has the molecular formula C19H30N4O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-[2-hydroxy-3-[(3-hydroxy-2-phenylpropanoyl)amino]propyl]hexanamide.
| Compound Name | 2-(carbamoylamino)-N-[2-hydroxy-3-[(3-hydroxy-2-phenylpropanoyl)amino]propyl]hexanamide |
|---|---|
| PubChem CID | 167750165 |
| Molecular Formula | C19H30N4O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 2-(carbamoylamino)-N-[2-hydroxy-3-[(3-hydroxy-2-phenylpropanoyl)amino]propyl]hexanamide |
| SMILES | CCCCC(NC(N)=O)C(=O)NCC(O)CNC(=O)C(CO)c1ccccc1 |
| InChI | InChI=1S/C19H30N4O5/c1-2-3-9-16(23-19(20)28)18(27)22-11-14(25)10-21-17(26)15(12-24)13-7-5-4-6-8-13/h4-8,14-16,24-25H,2-3,9-12H2,1H3,(H,21,26)(H,22,27)(H3,20,23,28) |
| InChIKey | VKLBZMFUSMJGTB-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |