C16H21ClN4O — CID 167753282
2-(3-chlorophenyl)-5-methyl-4-[2-(1-methyltriazol-4-yl)ethyl]morpholine (PubChem CID 167753282) has the molecular formula C16H21ClN4O and a molecular weight of 320.82 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-5-methyl-4-[2-(1-methyltriazol-4-yl)ethyl]morpholine.
| Compound Name | 2-(3-chlorophenyl)-5-methyl-4-[2-(1-methyltriazol-4-yl)ethyl]morpholine |
|---|---|
| PubChem CID | 167753282 |
| Molecular Formula | C16H21ClN4O |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 2-(3-chlorophenyl)-5-methyl-4-[2-(1-methyltriazol-4-yl)ethyl]morpholine |
| SMILES | CC1COC(c2cccc(Cl)c2)CN1CCc1cn(C)nn1 |
| InChI | InChI=1S/C16H21ClN4O/c1-12-11-22-16(13-4-3-5-14(17)8-13)10-21(12)7-6-15-9-20(2)19-18-15/h3-5,8-9,12,16H,6-7,10-11H2,1-2H3 |
| InChIKey | FOQMGGANXHIGHG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |