C18H23ClN4O — CID 125138246
(2S,5S)-2-(3-chlorophenyl)-5-methyl-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)morpholine (PubChem CID 125138246) has the molecular formula C18H23ClN4O and a molecular weight of 346.86 g/mol. Its IUPAC name is (2S,5S)-2-(3-chlorophenyl)-5-methyl-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)morpholine.
| Compound Name | (2S,5S)-2-(3-chlorophenyl)-5-methyl-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)morpholine |
|---|---|
| PubChem CID | 125138246 |
| Molecular Formula | C18H23ClN4O |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (2S,5S)-2-(3-chlorophenyl)-5-methyl-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)morpholine |
| SMILES | C[C@H]1CO[C@@H](c2cccc(Cl)c2)CN1Cc1nnc2n1CCCC2 |
| InChI | InChI=1S/C18H23ClN4O/c1-13-12-24-16(14-5-4-6-15(19)9-14)10-22(13)11-18-21-20-17-7-2-3-8-23(17)18/h4-6,9,13,16H,2-3,7-8,10-12H2,1H3/t13-,16+/m0/s1 |
| InChIKey | HGDATKWBTOXGRP-XJKSGUPXSA-N |
| XLogP | 3.23 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |