C20H20F3NO3 — CID 122034650
4-[[5-methyl-2-[3-(trifluoromethyl)phenyl]morpholin-4-yl]methyl]benzoic acid (PubChem CID 122034650) has the molecular formula C20H20F3NO3 and a molecular weight of 379.38 g/mol. Its IUPAC name is 4-[[5-methyl-2-[3-(trifluoromethyl)phenyl]morpholin-4-yl]methyl]benzoic acid.
| Compound Name | 4-[[5-methyl-2-[3-(trifluoromethyl)phenyl]morpholin-4-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 122034650 |
| Molecular Formula | C20H20F3NO3 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 4-[[5-methyl-2-[3-(trifluoromethyl)phenyl]morpholin-4-yl]methyl]benzoic acid |
| SMILES | CC1COC(c2cccc(C(F)(F)F)c2)CN1Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C20H20F3NO3/c1-13-12-27-18(16-3-2-4-17(9-16)20(21,22)23)11-24(13)10-14-5-7-15(8-6-14)19(25)26/h2-9,13,18H,10-12H2,1H3,(H,25,26) |
| InChIKey | DQXUJEIEWMYCOA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |