C18H16F3N3O2 — CID 167753380
1-[(4-methylphenyl)methyl]-3-[4-methyl-6-(trifluoromethyl)-3-pyridinyl]imidazolidine-2,4-dione (PubChem CID 167753380) has the molecular formula C18H16F3N3O2 and a molecular weight of 363.34 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methyl]-3-[4-methyl-6-(trifluoromethyl)-3-pyridinyl]imidazolidine-2,4-dione.
| Compound Name | 1-[(4-methylphenyl)methyl]-3-[4-methyl-6-(trifluoromethyl)-3-pyridinyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 167753380 |
| Molecular Formula | C18H16F3N3O2 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 1-[(4-methylphenyl)methyl]-3-[4-methyl-6-(trifluoromethyl)-3-pyridinyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(CN2CC(=O)N(c3cnc(C(F)(F)F)cc3C)C2=O)cc1 |
| InChI | InChI=1S/C18H16F3N3O2/c1-11-3-5-13(6-4-11)9-23-10-16(25)24(17(23)26)14-8-22-15(7-12(14)2)18(19,20)21/h3-8H,9-10H2,1-2H3 |
| InChIKey | QAPYOBQCSRGQRG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|