C21H24ClN3O4S — CID 166233909
N-tert-butyl-5-[3-[(4-chlorophenyl)methyl]-2,5-dioxoimidazolidin-1-yl]-2-methylbenzenesulfonamide (PubChem CID 166233909) has the molecular formula C21H24ClN3O4S and a molecular weight of 449.96 g/mol. Its IUPAC name is N-tert-butyl-5-[3-[(4-chlorophenyl)methyl]-2,5-dioxoimidazolidin-1-yl]-2-methylbenzenesulfonamide.
| Compound Name | N-tert-butyl-5-[3-[(4-chlorophenyl)methyl]-2,5-dioxoimidazolidin-1-yl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 166233909 |
| Molecular Formula | C21H24ClN3O4S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | N-tert-butyl-5-[3-[(4-chlorophenyl)methyl]-2,5-dioxoimidazolidin-1-yl]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(N2C(=O)CN(Cc3ccc(Cl)cc3)C2=O)cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C21H24ClN3O4S/c1-14-5-10-17(11-18(14)30(28,29)23-21(2,3)4)25-19(26)13-24(20(25)27)12-15-6-8-16(22)9-7-15/h5-11,23H,12-13H2,1-4H3 |
| InChIKey | SAUNZLUPGVRSTR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|