C20H21N3O4S — CID 166233908
5-(3-benzyl-2,5-dioxoimidazolidin-1-yl)-N-cyclopropyl-2-methylbenzenesulfonamide (PubChem CID 166233908) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 5-(3-benzyl-2,5-dioxoimidazolidin-1-yl)-N-cyclopropyl-2-methylbenzenesulfonamide.
| Compound Name | 5-(3-benzyl-2,5-dioxoimidazolidin-1-yl)-N-cyclopropyl-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 166233908 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 5-(3-benzyl-2,5-dioxoimidazolidin-1-yl)-N-cyclopropyl-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(N2C(=O)CN(Cc3ccccc3)C2=O)cc1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C20H21N3O4S/c1-14-7-10-17(11-18(14)28(26,27)21-16-8-9-16)23-19(24)13-22(20(23)25)12-15-5-3-2-4-6-15/h2-7,10-11,16,21H,8-9,12-13H2,1H3 |
| InChIKey | ORLWHYVZQPHJTH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|