C16H19F3N4O2 — CID 167756112
1-[(4-ethyl-1H-pyrazol-5-yl)methyl]-3-[2-hydroxy-1-[2-(trifluoromethyl)phenyl]ethyl]urea (PubChem CID 167756112) has the molecular formula C16H19F3N4O2 and a molecular weight of 356.35 g/mol. Its IUPAC name is 1-[(4-ethyl-1H-pyrazol-5-yl)methyl]-3-[2-hydroxy-1-[2-(trifluoromethyl)phenyl]ethyl]urea.
| Compound Name | 1-[(4-ethyl-1H-pyrazol-5-yl)methyl]-3-[2-hydroxy-1-[2-(trifluoromethyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 167756112 |
| Molecular Formula | C16H19F3N4O2 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 1-[(4-ethyl-1H-pyrazol-5-yl)methyl]-3-[2-hydroxy-1-[2-(trifluoromethyl)phenyl]ethyl]urea |
| SMILES | CCc1cn[nH]c1CNC(=O)NC(CO)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H19F3N4O2/c1-2-10-7-21-23-13(10)8-20-15(25)22-14(9-24)11-5-3-4-6-12(11)16(17,18)19/h3-7,14,24H,2,8-9H2,1H3,(H,21,23)(H2,20,22,25) |
| InChIKey | YCCQERMFSKDABH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |