About 6-bromo-3-(2,3-dihydro-1H-isoindol-5-yloxymethyl)-1,2-benzoxazole
6-bromo-3-(2,3-dihydro-1H-isoindol-5-yloxymethyl)-1,2-benzoxazole (PubChem CID 167756318) has the molecular formula C16H13BrN2O2
and a molecular weight of 345.20 g/mol. Its IUPAC name is 6-bromo-3-(2,3-dihydro-1H-isoindol-5-yloxymethyl)-1,2-benzoxazole.
Molecular Properties
| Compound Name | 6-bromo-3-(2,3-dihydro-1H-isoindol-5-yloxymethyl)-1,2-benzoxazole |
| PubChem CID | 167756318 |
| Molecular Formula | C16H13BrN2O2 |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 6-bromo-3-(2,3-dihydro-1H-isoindol-5-yloxymethyl)-1,2-benzoxazole |
| SMILES | Brc1ccc2c(COc3ccc4c(c3)CNC4)noc2c1 |
| InChI | InChI=1S/C16H13BrN2O2/c17-12-2-4-14-15(19-21-16(14)6-12)9-20-13-3-1-10-7-18-8-11(10)5-13/h1-6,18H,7-9H2 |
| InChIKey | ILGXZDJPJHYZFX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-3-(2,3-dihydro-1H-isoindol-5-yloxymethyl)-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-(2,3-dihydro-1H-isoindol-5-yloxymethyl)-1,2-benzoxazole?
The IUPAC name of 6-bromo-3-(2,3-dihydro-1H-isoindol-5-yloxymethyl)-1,2-benzoxazole (CID 167756318) is 6-bromo-3-(2,3-dihydro-1H-isoindol-5-yloxymethyl)-1,2-benzoxazole.
What is the SMILES notation for 6-bromo-3-(2,3-dihydro-1H-isoindol-5-yloxymethyl)-1,2-benzoxazole?
The canonical SMILES for 6-bromo-3-(2,3-dihydro-1H-isoindol-5-yloxymethyl)-1,2-benzoxazole is Brc1ccc2c(COc3ccc4c(c3)CNC4)noc2c1.
What is the InChIKey of 6-bromo-3-(2,3-dihydro-1H-isoindol-5-yloxymethyl)-1,2-benzoxazole?
The InChIKey is ILGXZDJPJHYZFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13BrN2O2/c17-12-2-4-14-15(19-21-16(14)6-12)9-20-13-3-1-10-7-18-8-11(10)5-13/h1-6,18H,7-9H2.
What are the key properties of 6-bromo-3-(2,3-dihydro-1H-isoindol-5-yloxymethyl)-1,2-benzoxazole?
6-bromo-3-(2,3-dihydro-1H-isoindol-5-yloxymethyl)-1,2-benzoxazole has a molecular weight of 345.20 g/mol, XLogP of 3.77, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-(2,3-dihydro-1H-isoindol-5-yloxymethyl)-1,2-benzoxazole is sourced from PubChem (CID 167756318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).