C12H20N2O4S — CID 167756740
3-cyclopentyl-N-(1,1,3-trioxothiazinan-4-yl)propanamide (PubChem CID 167756740) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is 3-cyclopentyl-N-(1,1,3-trioxothiazinan-4-yl)propanamide.
| Compound Name | 3-cyclopentyl-N-(1,1,3-trioxothiazinan-4-yl)propanamide |
|---|---|
| PubChem CID | 167756740 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 3-cyclopentyl-N-(1,1,3-trioxothiazinan-4-yl)propanamide |
| SMILES | O=C(CCC1CCCC1)NC1CCS(=O)(=O)NC1=O |
| InChI | InChI=1S/C12H20N2O4S/c15-11(6-5-9-3-1-2-4-9)13-10-7-8-19(17,18)14-12(10)16/h9-10H,1-8H2,(H,13,15)(H,14,16) |
| InChIKey | RBZUGNWYRPBJKM-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |