C19H23NO5 — CID 167757306
1-(oxan-4-yloxy)-3-(4-pyridin-2-yloxyphenoxy)propan-2-ol (PubChem CID 167757306) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is 1-(oxan-4-yloxy)-3-(4-pyridin-2-yloxyphenoxy)propan-2-ol.
| Compound Name | 1-(oxan-4-yloxy)-3-(4-pyridin-2-yloxyphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 167757306 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 1-(oxan-4-yloxy)-3-(4-pyridin-2-yloxyphenoxy)propan-2-ol |
| SMILES | OC(COc1ccc(Oc2ccccn2)cc1)COC1CCOCC1 |
| InChI | InChI=1S/C19H23NO5/c21-15(14-24-17-8-11-22-12-9-17)13-23-16-4-6-18(7-5-16)25-19-3-1-2-10-20-19/h1-7,10,15,17,21H,8-9,11-14H2 |
| InChIKey | GTQFZEYHARENBW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |