C17H21ClFNO3 — CID 167757330
2-chloro-N-(1,4-dioxaspiro[4.4]nonan-9-yl)-N-[(5-fluoro-2-methylphenyl)methyl]acetamide (PubChem CID 167757330) has the molecular formula C17H21ClFNO3 and a molecular weight of 341.81 g/mol. Its IUPAC name is 2-chloro-N-(1,4-dioxaspiro[4.4]nonan-9-yl)-N-[(5-fluoro-2-methylphenyl)methyl]acetamide.
| Compound Name | 2-chloro-N-(1,4-dioxaspiro[4.4]nonan-9-yl)-N-[(5-fluoro-2-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 167757330 |
| Molecular Formula | C17H21ClFNO3 |
| Molecular Weight | 341.81 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 2-chloro-N-(1,4-dioxaspiro[4.4]nonan-9-yl)-N-[(5-fluoro-2-methylphenyl)methyl]acetamide |
| SMILES | Cc1ccc(F)cc1CN(C(=O)CCl)C1CCCC12OCCO2 |
| InChI | InChI=1S/C17H21ClFNO3/c1-12-4-5-14(19)9-13(12)11-20(16(21)10-18)15-3-2-6-17(15)22-7-8-23-17/h4-5,9,15H,2-3,6-8,10-11H2,1H3 |
| InChIKey | IITUDTMFKOGIKC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.81 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|