C17H23ClFNO2 — CID 166424371
2-chloro-N-[(5-fluoro-2-methylphenyl)methyl]-N-[2-[(1S,2R)-2-hydroxycyclopentyl]ethyl]acetamide (PubChem CID 166424371) has the molecular formula C17H23ClFNO2 and a molecular weight of 327.83 g/mol. Its IUPAC name is 2-chloro-N-[(5-fluoro-2-methylphenyl)methyl]-N-[2-[(1S,2R)-2-hydroxycyclopentyl]ethyl]acetamide.
| Compound Name | 2-chloro-N-[(5-fluoro-2-methylphenyl)methyl]-N-[2-[(1S,2R)-2-hydroxycyclopentyl]ethyl]acetamide |
|---|---|
| PubChem CID | 166424371 |
| Molecular Formula | C17H23ClFNO2 |
| Molecular Weight | 327.83 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-chloro-N-[(5-fluoro-2-methylphenyl)methyl]-N-[2-[(1S,2R)-2-hydroxycyclopentyl]ethyl]acetamide |
| SMILES | Cc1ccc(F)cc1CN(CC[C@@H]1CCC[C@H]1O)C(=O)CCl |
| InChI | InChI=1S/C17H23ClFNO2/c1-12-5-6-15(19)9-14(12)11-20(17(22)10-18)8-7-13-3-2-4-16(13)21/h5-6,9,13,16,21H,2-4,7-8,10-11H2,1H3/t13-,16+/m0/s1 |
| InChIKey | XGNZNVNFQZBDQJ-XJKSGUPXSA-N |
| XLogP | 3.25 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.83 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|