C15H22O3S — CID 106585441
2-[2-(3,4-dimethylphenyl)sulfonylethyl]cyclopentan-1-ol (PubChem CID 106585441) has the molecular formula C15H22O3S and a molecular weight of 282.40 g/mol. Its IUPAC name is 2-[2-(3,4-dimethylphenyl)sulfonylethyl]cyclopentan-1-ol.
| Compound Name | 2-[2-(3,4-dimethylphenyl)sulfonylethyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 106585441 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2-[2-(3,4-dimethylphenyl)sulfonylethyl]cyclopentan-1-ol |
| SMILES | Cc1ccc(S(=O)(=O)CCC2CCCC2O)cc1C |
| InChI | InChI=1S/C15H22O3S/c1-11-6-7-14(10-12(11)2)19(17,18)9-8-13-4-3-5-15(13)16/h6-7,10,13,15-16H,3-5,8-9H2,1-2H3 |
| InChIKey | ORVCXDDZKSQMIQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |