C20H26N4O3S — CID 167759916
N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-3-(sulfamoylmethyl)benzamide (PubChem CID 167759916) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-3-(sulfamoylmethyl)benzamide.
| Compound Name | N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-3-(sulfamoylmethyl)benzamide |
|---|---|
| PubChem CID | 167759916 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-3-(sulfamoylmethyl)benzamide |
| SMILES | NS(=O)(=O)Cc1cccc(C(=O)NCc2ccnc(N3CCCCCC3)c2)c1 |
| InChI | InChI=1S/C20H26N4O3S/c21-28(26,27)15-17-6-5-7-18(12-17)20(25)23-14-16-8-9-22-19(13-16)24-10-3-1-2-4-11-24/h5-9,12-13H,1-4,10-11,14-15H2,(H,23,25)(H2,21,26,27) |
| InChIKey | ALJWVWNUCFXKCY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |