C11H14FNO4S2 — CID 16776066
2-[(3-fluorophenyl)sulfonylamino]-3-methyl-3-sulfanylbutanoic acid (PubChem CID 16776066) has the molecular formula C11H14FNO4S2 and a molecular weight of 307.37 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)sulfonylamino]-3-methyl-3-sulfanylbutanoic acid.
| Compound Name | 2-[(3-fluorophenyl)sulfonylamino]-3-methyl-3-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 16776066 |
| Molecular Formula | C11H14FNO4S2 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 2-[(3-fluorophenyl)sulfonylamino]-3-methyl-3-sulfanylbutanoic acid |
| SMILES | CC(C)(S)C(NS(=O)(=O)c1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C11H14FNO4S2/c1-11(2,18)9(10(14)15)13-19(16,17)8-5-3-4-7(12)6-8/h3-6,9,13,18H,1-2H3,(H,14,15) |
| InChIKey | XYTWIZXEFMTPIB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|