C14H13ClF3N5O2 — CID 167761647
2-chloro-6-morpholin-4-yl-N-[5-(trifluoromethyl)-1H-imidazol-2-yl]pyridine-4-carboxamide (PubChem CID 167761647) has the molecular formula C14H13ClF3N5O2 and a molecular weight of 375.74 g/mol. Its IUPAC name is 2-chloro-6-morpholin-4-yl-N-[5-(trifluoromethyl)-1H-imidazol-2-yl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-6-morpholin-4-yl-N-[5-(trifluoromethyl)-1H-imidazol-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 167761647 |
| Molecular Formula | C14H13ClF3N5O2 |
| Molecular Weight | 375.74 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 2-chloro-6-morpholin-4-yl-N-[5-(trifluoromethyl)-1H-imidazol-2-yl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1ncc(C(F)(F)F)[nH]1)c1cc(Cl)nc(N2CCOCC2)c1 |
| InChI | InChI=1S/C14H13ClF3N5O2/c15-10-5-8(6-11(21-10)23-1-3-25-4-2-23)12(24)22-13-19-7-9(20-13)14(16,17)18/h5-7H,1-4H2,(H2,19,20,22,24) |
| InChIKey | GZPJWATVUTZVJA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.74 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|