C20H26ClN3O4 — CID 167764036
(E)-1-(4-methoxyphenyl)-4-[4-(pyrrolidine-2-carbonyl)piperazin-1-yl]but-2-ene-1,4-dione;hydrochloride (PubChem CID 167764036) has the molecular formula C20H26ClN3O4 and a molecular weight of 407.90 g/mol. Its IUPAC name is (E)-1-(4-methoxyphenyl)-4-[4-(pyrrolidine-2-carbonyl)piperazin-1-yl]but-2-ene-1,4-dione;hydrochloride.
| Compound Name | (E)-1-(4-methoxyphenyl)-4-[4-(pyrrolidine-2-carbonyl)piperazin-1-yl]but-2-ene-1,4-dione;hydrochloride |
|---|---|
| PubChem CID | 167764036 |
| Molecular Formula | C20H26ClN3O4 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | (E)-1-(4-methoxyphenyl)-4-[4-(pyrrolidine-2-carbonyl)piperazin-1-yl]but-2-ene-1,4-dione;hydrochloride |
| SMILES | COc1ccc(C(=O)/C=C/C(=O)N2CCN(C(=O)C3CCCN3)CC2)cc1.Cl |
| InChI | InChI=1S/C20H25N3O4.ClH/c1-27-16-6-4-15(5-7-16)18(24)8-9-19(25)22-11-13-23(14-12-22)20(26)17-3-2-10-21-17;/h4-9,17,21H,2-3,10-14H2,1H3;1H/b9-8+; |
| InChIKey | WNBDATVHQOPOBB-HRNDJLQDSA-N |
| XLogP | 1.28 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|