C25H29BrFN3O2 — CID 167764929
N-[1-(3-bromophenyl)-3-propoxypropan-2-yl]-1-(2-cyano-4-fluorophenyl)piperidine-4-carboxamide (PubChem CID 167764929) has the molecular formula C25H29BrFN3O2 and a molecular weight of 502.43 g/mol. Its IUPAC name is N-[1-(3-bromophenyl)-3-propoxypropan-2-yl]-1-(2-cyano-4-fluorophenyl)piperidine-4-carboxamide.
| Compound Name | N-[1-(3-bromophenyl)-3-propoxypropan-2-yl]-1-(2-cyano-4-fluorophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 167764929 |
| Molecular Formula | C25H29BrFN3O2 |
| Molecular Weight | 502.43 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | N-[1-(3-bromophenyl)-3-propoxypropan-2-yl]-1-(2-cyano-4-fluorophenyl)piperidine-4-carboxamide |
| SMILES | CCCOCC(Cc1cccc(Br)c1)NC(=O)C1CCN(c2ccc(F)cc2C#N)CC1 |
| InChI | InChI=1S/C25H29BrFN3O2/c1-2-12-32-17-23(14-18-4-3-5-21(26)13-18)29-25(31)19-8-10-30(11-9-19)24-7-6-22(27)15-20(24)16-28/h3-7,13,15,19,23H,2,8-12,14,17H2,1H3,(H,29,31) |
| InChIKey | KIPCOEAUYNAJDY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|