C25H31N5O2 — CID 167766339
1-(5-benzyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)-3-[4-(4-hydroxyphenyl)butan-2-yl]urea (PubChem CID 167766339) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 1-(5-benzyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)-3-[4-(4-hydroxyphenyl)butan-2-yl]urea.
| Compound Name | 1-(5-benzyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)-3-[4-(4-hydroxyphenyl)butan-2-yl]urea |
|---|---|
| PubChem CID | 167766339 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 1-(5-benzyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)-3-[4-(4-hydroxyphenyl)butan-2-yl]urea |
| SMILES | CC(CCc1ccc(O)cc1)NC(=O)Nc1cc2n(n1)CCCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C25H31N5O2/c1-19(8-9-20-10-12-23(31)13-11-20)26-25(32)27-24-16-22-18-29(14-5-15-30(22)28-24)17-21-6-3-2-4-7-21/h2-4,6-7,10-13,16,19,31H,5,8-9,14-15,17-18H2,1H3,(H2,26,27,28,32) |
| InChIKey | AQZNNADBDXZULL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |