C22H27N5O2 — CID 167767779
N-[(1-benzyl-4-methylpiperazin-2-yl)methyl]-4-hydroxy-1-methylindazole-6-carboxamide (PubChem CID 167767779) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-[(1-benzyl-4-methylpiperazin-2-yl)methyl]-4-hydroxy-1-methylindazole-6-carboxamide.
| Compound Name | N-[(1-benzyl-4-methylpiperazin-2-yl)methyl]-4-hydroxy-1-methylindazole-6-carboxamide |
|---|---|
| PubChem CID | 167767779 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | N-[(1-benzyl-4-methylpiperazin-2-yl)methyl]-4-hydroxy-1-methylindazole-6-carboxamide |
| SMILES | CN1CCN(Cc2ccccc2)C(CNC(=O)c2cc(O)c3cnn(C)c3c2)C1 |
| InChI | InChI=1S/C22H27N5O2/c1-25-8-9-27(14-16-6-4-3-5-7-16)18(15-25)12-23-22(29)17-10-20-19(21(28)11-17)13-24-26(20)2/h3-7,10-11,13,18,28H,8-9,12,14-15H2,1-2H3,(H,23,29) |
| InChIKey | PDTCUBMDFDGYNY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |