C21H30N4OS — CID 100633586
N-[[(3R)-4-benzylthiomorpholin-3-yl]methyl]-1-tert-butyl-5-methylpyrazole-4-carboxamide (PubChem CID 100633586) has the molecular formula C21H30N4OS and a molecular weight of 386.57 g/mol. Its IUPAC name is N-[[(3R)-4-benzylthiomorpholin-3-yl]methyl]-1-tert-butyl-5-methylpyrazole-4-carboxamide.
| Compound Name | N-[[(3R)-4-benzylthiomorpholin-3-yl]methyl]-1-tert-butyl-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 100633586 |
| Molecular Formula | C21H30N4OS |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-[[(3R)-4-benzylthiomorpholin-3-yl]methyl]-1-tert-butyl-5-methylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NC[C@@H]2CSCCN2Cc2ccccc2)cnn1C(C)(C)C |
| InChI | InChI=1S/C21H30N4OS/c1-16-19(13-23-25(16)21(2,3)4)20(26)22-12-18-15-27-11-10-24(18)14-17-8-6-5-7-9-17/h5-9,13,18H,10-12,14-15H2,1-4H3,(H,22,26)/t18-/m1/s1 |
| InChIKey | CRMSRZKDCWZRNM-GOSISDBHSA-N |
| XLogP | 3.29 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |