C17H24FN3OS — CID 146105641
1-[(4-benzylthiomorpholin-3-yl)methyl]-3-(3-fluorocyclobutyl)urea (PubChem CID 146105641) has the molecular formula C17H24FN3OS and a molecular weight of 337.46 g/mol. Its IUPAC name is 1-[(4-benzylthiomorpholin-3-yl)methyl]-3-(3-fluorocyclobutyl)urea.
| Compound Name | 1-[(4-benzylthiomorpholin-3-yl)methyl]-3-(3-fluorocyclobutyl)urea |
|---|---|
| PubChem CID | 146105641 |
| Molecular Formula | C17H24FN3OS |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 1-[(4-benzylthiomorpholin-3-yl)methyl]-3-(3-fluorocyclobutyl)urea |
| SMILES | O=C(NCC1CSCCN1Cc1ccccc1)NC1CC(F)C1 |
| InChI | InChI=1S/C17H24FN3OS/c18-14-8-15(9-14)20-17(22)19-10-16-12-23-7-6-21(16)11-13-4-2-1-3-5-13/h1-5,14-16H,6-12H2,(H2,19,20,22) |
| InChIKey | PCNIAZJTUYSVPY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |