C12H7F2NO3S — CID 16776930
3-[(2,4-difluorobenzoyl)amino]thiophene-2-carboxylic acid (PubChem CID 16776930) has the molecular formula C12H7F2NO3S and a molecular weight of 283.26 g/mol. Its IUPAC name is 3-[(2,4-difluorobenzoyl)amino]thiophene-2-carboxylic acid.
| Compound Name | 3-[(2,4-difluorobenzoyl)amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 16776930 |
| Molecular Formula | C12H7F2NO3S |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 3-[(2,4-difluorobenzoyl)amino]thiophene-2-carboxylic acid |
| SMILES | O=C(Nc1ccsc1C(=O)O)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H7F2NO3S/c13-6-1-2-7(8(14)5-6)11(16)15-9-3-4-19-10(9)12(17)18/h1-5H,(H,15,16)(H,17,18) |
| InChIKey | BDOVPHIXYWCUHP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |