C12H6Cl2FNO3S — CID 43171762
3-[(2,4-dichloro-5-fluorobenzoyl)amino]thiophene-2-carboxylic acid (PubChem CID 43171762) has the molecular formula C12H6Cl2FNO3S and a molecular weight of 334.16 g/mol. Its IUPAC name is 3-[(2,4-dichloro-5-fluorobenzoyl)amino]thiophene-2-carboxylic acid.
| Compound Name | 3-[(2,4-dichloro-5-fluorobenzoyl)amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43171762 |
| Molecular Formula | C12H6Cl2FNO3S |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 332.94 |
| IUPAC Name | 3-[(2,4-dichloro-5-fluorobenzoyl)amino]thiophene-2-carboxylic acid |
| SMILES | O=C(Nc1ccsc1C(=O)O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H6Cl2FNO3S/c13-6-4-7(14)8(15)3-5(6)11(17)16-9-1-2-20-10(9)12(18)19/h1-4H,(H,16,17)(H,18,19) |
| InChIKey | BVTJNSULKIQYHD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|