C18H19FN4O — CID 167770616
1-(6-fluoroquinolin-2-yl)-4-(2-methylpyrazol-3-yl)piperidin-4-ol (PubChem CID 167770616) has the molecular formula C18H19FN4O and a molecular weight of 326.38 g/mol. Its IUPAC name is 1-(6-fluoroquinolin-2-yl)-4-(2-methylpyrazol-3-yl)piperidin-4-ol.
| Compound Name | 1-(6-fluoroquinolin-2-yl)-4-(2-methylpyrazol-3-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 167770616 |
| Molecular Formula | C18H19FN4O |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1-(6-fluoroquinolin-2-yl)-4-(2-methylpyrazol-3-yl)piperidin-4-ol |
| SMILES | Cn1nccc1C1(O)CCN(c2ccc3cc(F)ccc3n2)CC1 |
| InChI | InChI=1S/C18H19FN4O/c1-22-16(6-9-20-22)18(24)7-10-23(11-8-18)17-5-2-13-12-14(19)3-4-15(13)21-17/h2-6,9,12,24H,7-8,10-11H2,1H3 |
| InChIKey | IOIPWQWFHSWYNR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |