C17H29N5O2 — CID 167771837
1-[6-oxo-2-(2-propan-2-ylpyrazol-3-yl)piperidin-3-yl]-3-pentylurea (PubChem CID 167771837) has the molecular formula C17H29N5O2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-[6-oxo-2-(2-propan-2-ylpyrazol-3-yl)piperidin-3-yl]-3-pentylurea.
| Compound Name | 1-[6-oxo-2-(2-propan-2-ylpyrazol-3-yl)piperidin-3-yl]-3-pentylurea |
|---|---|
| PubChem CID | 167771837 |
| Molecular Formula | C17H29N5O2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | 1-[6-oxo-2-(2-propan-2-ylpyrazol-3-yl)piperidin-3-yl]-3-pentylurea |
| SMILES | CCCCCNC(=O)NC1CCC(=O)NC1c1ccnn1C(C)C |
| InChI | InChI=1S/C17H29N5O2/c1-4-5-6-10-18-17(24)20-13-7-8-15(23)21-16(13)14-9-11-19-22(14)12(2)3/h9,11-13,16H,4-8,10H2,1-3H3,(H,21,23)(H2,18,20,24) |
| InChIKey | HEMPDDZBBUXJPR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|