About cyclohexylmethyl N-[(2R,3R)-2-(2-methylpyrazol-3-yl)-6-oxopiperidin-3-yl]carbamate
cyclohexylmethyl N-[(2R,3R)-2-(2-methylpyrazol-3-yl)-6-oxopiperidin-3-yl]carbamate (PubChem CID 127266887) has the molecular formula C17H26N4O3
and a molecular weight of 334.42 g/mol. Its IUPAC name is cyclohexylmethyl N-[(2R,3R)-2-(2-methylpyrazol-3-yl)-6-oxopiperidin-3-yl]carbamate.
Molecular Properties
| Compound Name | cyclohexylmethyl N-[(2R,3R)-2-(2-methylpyrazol-3-yl)-6-oxopiperidin-3-yl]carbamate |
| PubChem CID | 127266887 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | cyclohexylmethyl N-[(2R,3R)-2-(2-methylpyrazol-3-yl)-6-oxopiperidin-3-yl]carbamate |
| SMILES | Cn1nccc1[C@@H]1NC(=O)CC[C@H]1NC(=O)OCC1CCCCC1 |
| InChI | InChI=1S/C17H26N4O3/c1-21-14(9-10-18-21)16-13(7-8-15(22)20-16)19-17(23)24-11-12-5-3-2-4-6-12/h9-10,12-13,16H,2-8,11H2,1H3,(H,19,23)(H,20,22)/t13-,16-/m1/s1 |
| InChIKey | FAFZJVMKBWVGIS-CZUORRHYSA-N |
| XLogP | 2.05 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclohexylmethyl N-[(2R,3R)-2-(2-methylpyrazol-3-yl)-6-oxopiperidin-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylmethyl N-[(2R,3R)-2-(2-methylpyrazol-3-yl)-6-oxopiperidin-3-yl]carbamate?
The IUPAC name of cyclohexylmethyl N-[(2R,3R)-2-(2-methylpyrazol-3-yl)-6-oxopiperidin-3-yl]carbamate (CID 127266887) is cyclohexylmethyl N-[(2R,3R)-2-(2-methylpyrazol-3-yl)-6-oxopiperidin-3-yl]carbamate.
What is the SMILES notation for cyclohexylmethyl N-[(2R,3R)-2-(2-methylpyrazol-3-yl)-6-oxopiperidin-3-yl]carbamate?
The canonical SMILES for cyclohexylmethyl N-[(2R,3R)-2-(2-methylpyrazol-3-yl)-6-oxopiperidin-3-yl]carbamate is Cn1nccc1[C@@H]1NC(=O)CC[C@H]1NC(=O)OCC1CCCCC1.
What is the InChIKey of cyclohexylmethyl N-[(2R,3R)-2-(2-methylpyrazol-3-yl)-6-oxopiperidin-3-yl]carbamate?
The InChIKey is FAFZJVMKBWVGIS-CZUORRHYSA-N. The full InChI is InChI=1S/C17H26N4O3/c1-21-14(9-10-18-21)16-13(7-8-15(22)20-16)19-17(23)24-11-12-5-3-2-4-6-12/h9-10,12-13,16H,2-8,11H2,1H3,(H,19,23)(H,20,22)/t13-,16-/m1/s1.
What are the key properties of cyclohexylmethyl N-[(2R,3R)-2-(2-methylpyrazol-3-yl)-6-oxopiperidin-3-yl]carbamate?
cyclohexylmethyl N-[(2R,3R)-2-(2-methylpyrazol-3-yl)-6-oxopiperidin-3-yl]carbamate has a molecular weight of 334.42 g/mol, XLogP of 2.05, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylmethyl N-[(2R,3R)-2-(2-methylpyrazol-3-yl)-6-oxopiperidin-3-yl]carbamate is sourced from PubChem (CID 127266887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).