C16H26N2O3 — CID 167774944
ethyl 5-(2-methylpropyl)-1-(oxan-2-ylmethyl)pyrazole-3-carboxylate (PubChem CID 167774944) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is ethyl 5-(2-methylpropyl)-1-(oxan-2-ylmethyl)pyrazole-3-carboxylate.
| Compound Name | ethyl 5-(2-methylpropyl)-1-(oxan-2-ylmethyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 167774944 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | ethyl 5-(2-methylpropyl)-1-(oxan-2-ylmethyl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CC(C)C)n(CC2CCCCO2)n1 |
| InChI | InChI=1S/C16H26N2O3/c1-4-20-16(19)15-10-13(9-12(2)3)18(17-15)11-14-7-5-6-8-21-14/h10,12,14H,4-9,11H2,1-3H3 |
| InChIKey | LHVIBGTVINSCEB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |