C17H19FN2O3 — CID 167776034
1-cyclopentyl-3-[3-(4-fluorophenyl)-3-oxopropyl]imidazolidine-2,4-dione (PubChem CID 167776034) has the molecular formula C17H19FN2O3 and a molecular weight of 318.35 g/mol. Its IUPAC name is 1-cyclopentyl-3-[3-(4-fluorophenyl)-3-oxopropyl]imidazolidine-2,4-dione.
| Compound Name | 1-cyclopentyl-3-[3-(4-fluorophenyl)-3-oxopropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 167776034 |
| Molecular Formula | C17H19FN2O3 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1-cyclopentyl-3-[3-(4-fluorophenyl)-3-oxopropyl]imidazolidine-2,4-dione |
| SMILES | O=C(CCN1C(=O)CN(C2CCCC2)C1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H19FN2O3/c18-13-7-5-12(6-8-13)15(21)9-10-19-16(22)11-20(17(19)23)14-3-1-2-4-14/h5-8,14H,1-4,9-11H2 |
| InChIKey | CCMJZMRWAWCDHI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|